C8H18N2O4S — CID 112685988
ethyl 2-[2-methylpropyl(sulfamoyl)amino]acetate (PubChem CID 112685988) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is ethyl 2-[2-methylpropyl(sulfamoyl)amino]acetate.
| Compound Name | ethyl 2-[2-methylpropyl(sulfamoyl)amino]acetate |
|---|---|
| PubChem CID | 112685988 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethyl 2-[2-methylpropyl(sulfamoyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C8H18N2O4S/c1-4-14-8(11)6-10(5-7(2)3)15(9,12)13/h7H,4-6H2,1-3H3,(H2,9,12,13) |
| InChIKey | RXLOVVGLFBAQKP-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |