C15H20F3NO4S — CID 55663353
ethyl 2-[2-methylpropyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 55663353) has the molecular formula C15H20F3NO4S and a molecular weight of 367.39 g/mol. Its IUPAC name is ethyl 2-[2-methylpropyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-[2-methylpropyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55663353 |
| Molecular Formula | C15H20F3NO4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl 2-[2-methylpropyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)CN(CC(C)C)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO4S/c1-4-23-14(20)10-19(9-11(2)3)24(21,22)13-8-6-5-7-12(13)15(16,17)18/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | SEIWXGDZFMNVOQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |