C14H19F2NO6S2 — CID 100675052
ethyl 2-[[2-(difluoromethylsulfonyl)phenyl]sulfonyl-propylamino]acetate (PubChem CID 100675052) has the molecular formula C14H19F2NO6S2 and a molecular weight of 399.44 g/mol. Its IUPAC name is ethyl 2-[[2-(difluoromethylsulfonyl)phenyl]sulfonyl-propylamino]acetate.
| Compound Name | ethyl 2-[[2-(difluoromethylsulfonyl)phenyl]sulfonyl-propylamino]acetate |
|---|---|
| PubChem CID | 100675052 |
| Molecular Formula | C14H19F2NO6S2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | ethyl 2-[[2-(difluoromethylsulfonyl)phenyl]sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)S(=O)(=O)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C14H19F2NO6S2/c1-3-9-17(10-13(18)23-4-2)25(21,22)12-8-6-5-7-11(12)24(19,20)14(15)16/h5-8,14H,3-4,9-10H2,1-2H3 |
| InChIKey | PJJJKXHQIYPTHC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |