C17H27NO4S — CID 55855485
ethyl 2-[(4-tert-butylphenyl)sulfonyl-propylamino]acetate (PubChem CID 55855485) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is ethyl 2-[(4-tert-butylphenyl)sulfonyl-propylamino]acetate.
| Compound Name | ethyl 2-[(4-tert-butylphenyl)sulfonyl-propylamino]acetate |
|---|---|
| PubChem CID | 55855485 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | ethyl 2-[(4-tert-butylphenyl)sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27NO4S/c1-6-12-18(13-16(19)22-7-2)23(20,21)15-10-8-14(9-11-15)17(3,4)5/h8-11H,6-7,12-13H2,1-5H3 |
| InChIKey | SHOCDEAEKHPTDR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |