C14H20ClNO6S2 — CID 47059378
ethyl 2-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-propylamino]acetate (PubChem CID 47059378) has the molecular formula C14H20ClNO6S2 and a molecular weight of 397.90 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-propylamino]acetate.
| Compound Name | ethyl 2-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-propylamino]acetate |
|---|---|
| PubChem CID | 47059378 |
| Molecular Formula | C14H20ClNO6S2 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | ethyl 2-[(2-chloro-5-methylsulfonylphenyl)sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C14H20ClNO6S2/c1-4-8-16(10-14(17)22-5-2)24(20,21)13-9-11(23(3,18)19)6-7-12(13)15/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | YCMPIOCRRBQNDQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |