C13H20N2O4S — CID 62007209
ethyl 2-(N-propyl-2-sulfamoylanilino)acetate (PubChem CID 62007209) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is ethyl 2-(N-propyl-2-sulfamoylanilino)acetate.
| Compound Name | ethyl 2-(N-propyl-2-sulfamoylanilino)acetate |
|---|---|
| PubChem CID | 62007209 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl 2-(N-propyl-2-sulfamoylanilino)acetate |
| SMILES | CCCN(CC(=O)OCC)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H20N2O4S/c1-3-9-15(10-13(16)19-4-2)11-7-5-6-8-12(11)20(14,17)18/h5-8H,3-4,9-10H2,1-2H3,(H2,14,17,18) |
| InChIKey | IRAVFSMOAYCVME-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |