C12H22N4O4S — CID 61107552
ethyl 2-[(3-amino-1-methylpyrazol-4-yl)sulfonyl-(2-methylpropyl)amino]acetate (PubChem CID 61107552) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is ethyl 2-[(3-amino-1-methylpyrazol-4-yl)sulfonyl-(2-methylpropyl)amino]acetate.
| Compound Name | ethyl 2-[(3-amino-1-methylpyrazol-4-yl)sulfonyl-(2-methylpropyl)amino]acetate |
|---|---|
| PubChem CID | 61107552 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | ethyl 2-[(3-amino-1-methylpyrazol-4-yl)sulfonyl-(2-methylpropyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(C)C)S(=O)(=O)c1cn(C)nc1N |
| InChI | InChI=1S/C12H22N4O4S/c1-5-20-11(17)8-16(6-9(2)3)21(18,19)10-7-15(4)14-12(10)13/h7,9H,5-6,8H2,1-4H3,(H2,13,14) |
| InChIKey | NFTMVICIPNPBCL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |