C13H26N2O5S — CID 60947867
ethyl 2-[(2-amino-4-methylsulfonylbutanoyl)-(2-methylpropyl)amino]acetate (PubChem CID 60947867) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 2-[(2-amino-4-methylsulfonylbutanoyl)-(2-methylpropyl)amino]acetate.
| Compound Name | ethyl 2-[(2-amino-4-methylsulfonylbutanoyl)-(2-methylpropyl)amino]acetate |
|---|---|
| PubChem CID | 60947867 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 2-[(2-amino-4-methylsulfonylbutanoyl)-(2-methylpropyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(C)C)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O5S/c1-5-20-12(16)9-15(8-10(2)3)13(17)11(14)6-7-21(4,18)19/h10-11H,5-9,14H2,1-4H3 |
| InChIKey | SOASMNSOXQPUQO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |