C12H23N3O3S — CID 54873679
2-amino-N-(2-cyanoethyl)-N-(2-methylpropyl)-4-methylsulfonylbutanamide (PubChem CID 54873679) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-N-(2-methylpropyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-N-(2-methylpropyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 54873679 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-N-(2-methylpropyl)-4-methylsulfonylbutanamide |
| SMILES | CC(C)CN(CCC#N)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H23N3O3S/c1-10(2)9-15(7-4-6-13)12(16)11(14)5-8-19(3,17)18/h10-11H,4-5,7-9,14H2,1-3H3 |
| InChIKey | DKORNPPEGNUOIC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |