C10H19NO6S — CID 63064138
2-[(2-ethoxy-2-oxoethyl)sulfonyl-(2-methylpropyl)amino]acetic acid (PubChem CID 63064138) has the molecular formula C10H19NO6S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-[(2-ethoxy-2-oxoethyl)sulfonyl-(2-methylpropyl)amino]acetic acid.
| Compound Name | 2-[(2-ethoxy-2-oxoethyl)sulfonyl-(2-methylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 63064138 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(2-ethoxy-2-oxoethyl)sulfonyl-(2-methylpropyl)amino]acetic acid |
| SMILES | CCOC(=O)CS(=O)(=O)N(CC(=O)O)CC(C)C |
| InChI | InChI=1S/C10H19NO6S/c1-4-17-10(14)7-18(15,16)11(5-8(2)3)6-9(12)13/h8H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | ODCOQEBQOCTHFL-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |