C10H22N2O4S — CID 55007438
3-[[butyl(methyl)sulfamoyl]-methylamino]-2-methylpropanoic acid (PubChem CID 55007438) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-[[butyl(methyl)sulfamoyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[butyl(methyl)sulfamoyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 55007438 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-[[butyl(methyl)sulfamoyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CCCCN(C)S(=O)(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C10H22N2O4S/c1-5-6-7-11(3)17(15,16)12(4)8-9(2)10(13)14/h9H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | JTWAWQOUJYQBDY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |