C8H12N2O3 — CID 60957663
N-ethyl-N-(2-hydroxyethyl)-1,2-oxazole-5-carboxamide (PubChem CID 60957663) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 60957663 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-1,2-oxazole-5-carboxamide |
| SMILES | CCN(CCO)C(=O)c1ccno1 |
| InChI | InChI=1S/C8H12N2O3/c1-2-10(5-6-11)8(12)7-3-4-9-13-7/h3-4,11H,2,5-6H2,1H3 |
| InChIKey | LZPFWEATXUNCRY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |