C9H13NO3 — CID 39237533
N-ethyl-N-(2-hydroxyethyl)furan-2-carboxamide (PubChem CID 39237533) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)furan-2-carboxamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 39237533 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)furan-2-carboxamide |
| SMILES | CCN(CCO)C(=O)c1ccco1 |
| InChI | InChI=1S/C9H13NO3/c1-2-10(5-6-11)9(12)8-4-3-7-13-8/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | CTMACMYIOIRRCS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |