C9H11Cl2NO2 — CID 15923
N,N-bis(2-chloroethyl)furan-2-carboxamide (PubChem CID 15923) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)furan-2-carboxamide.
| Compound Name | N,N-bis(2-chloroethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 15923 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | N,N-bis(2-chloroethyl)furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(CCCl)CCCl |
| InChI | InChI=1S/C9H11Cl2NO2/c10-3-5-12(6-4-11)9(13)8-2-1-7-14-8/h1-2,7H,3-6H2 |
| InChIKey | FDXZANUMEUHQMF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|