C9H12F2N2O2 — CID 107493246
N-(2-aminoethyl)-N-(2,2-difluoroethyl)furan-2-carboxamide (PubChem CID 107493246) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2,2-difluoroethyl)furan-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-(2,2-difluoroethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 107493246 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | N-(2-aminoethyl)-N-(2,2-difluoroethyl)furan-2-carboxamide |
| SMILES | NCCN(CC(F)F)C(=O)c1ccco1 |
| InChI | InChI=1S/C9H12F2N2O2/c10-8(11)6-13(4-3-12)9(14)7-2-1-5-15-7/h1-2,5,8H,3-4,6,12H2 |
| InChIKey | VDUYAFKIHHALPB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |