C15H13NO2S2 — CID 60682593
N,N-bis(thiophen-2-ylmethyl)furan-2-carboxamide (PubChem CID 60682593) has the molecular formula C15H13NO2S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N,N-bis(thiophen-2-ylmethyl)furan-2-carboxamide.
| Compound Name | N,N-bis(thiophen-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60682593 |
| Molecular Formula | C15H13NO2S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N,N-bis(thiophen-2-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C15H13NO2S2/c17-15(14-6-1-7-18-14)16(10-12-4-2-8-19-12)11-13-5-3-9-20-13/h1-9H,10-11H2 |
| InChIKey | WJKXJAPJWTYDOX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |