C6H8N2O3 — CID 58418442
N-(hydroxymethyl)-N-methyl-1,2-oxazole-5-carboxamide (PubChem CID 58418442) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is N-(hydroxymethyl)-N-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(hydroxymethyl)-N-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 58418442 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | N-(hydroxymethyl)-N-methyl-1,2-oxazole-5-carboxamide |
| SMILES | CN(CO)C(=O)c1ccno1 |
| InChI | InChI=1S/C6H8N2O3/c1-8(4-9)6(10)5-2-3-7-11-5/h2-3,9H,4H2,1H3 |
| InChIKey | JOFVVRKHWCRUPS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|