C10H15N3O2 — CID 63643873
N-methyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide (PubChem CID 63643873) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-methyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N-methyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 63643873 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-methyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccno1)C1CCCNC1 |
| InChI | InChI=1S/C10H15N3O2/c1-13(8-3-2-5-11-7-8)10(14)9-4-6-12-15-9/h4,6,8,11H,2-3,5,7H2,1H3 |
| InChIKey | WUIAKKLYCPGGAP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |