C8H11N3O2 — CID 66186851
N-(azetidin-3-yl)-N-methyl-1,2-oxazole-5-carboxamide (PubChem CID 66186851) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(azetidin-3-yl)-N-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 66186851 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(azetidin-3-yl)-N-methyl-1,2-oxazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccno1)C1CNC1 |
| InChI | InChI=1S/C8H11N3O2/c1-11(6-4-9-5-6)8(12)7-2-3-10-13-7/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | BZIDYXGKCVXTAT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |