C11H14N2O4 — CID 55005865
ethyl 2-[cyclopropyl(1,2-oxazole-5-carbonyl)amino]acetate (PubChem CID 55005865) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl(1,2-oxazole-5-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl(1,2-oxazole-5-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 55005865 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethyl 2-[cyclopropyl(1,2-oxazole-5-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1ccno1)C1CC1 |
| InChI | InChI=1S/C11H14N2O4/c1-2-16-10(14)7-13(8-3-4-8)11(15)9-5-6-12-17-9/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | MUVYUXLTOVLOAU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |