C11H17N3O2 — CID 63641758
N,3-dimethyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide (PubChem CID 63641758) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N,3-dimethyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide.
| Compound Name | N,3-dimethyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 63641758 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N,3-dimethyl-N-piperidin-3-yl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C2CCCNC2)on1 |
| InChI | InChI=1S/C11H17N3O2/c1-8-6-10(16-13-8)11(15)14(2)9-4-3-5-12-7-9/h6,9,12H,3-5,7H2,1-2H3 |
| InChIKey | QBBWXQSTDBBSNL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |