C12H18N2O2 — CID 60807065
N,2-dimethyl-N-piperidin-3-ylfuran-3-carboxamide (PubChem CID 60807065) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N,2-dimethyl-N-piperidin-3-ylfuran-3-carboxamide.
| Compound Name | N,2-dimethyl-N-piperidin-3-ylfuran-3-carboxamide |
|---|---|
| PubChem CID | 60807065 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N,2-dimethyl-N-piperidin-3-ylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N(C)C1CCCNC1 |
| InChI | InChI=1S/C12H18N2O2/c1-9-11(5-7-16-9)12(15)14(2)10-4-3-6-13-8-10/h5,7,10,13H,3-4,6,8H2,1-2H3 |
| InChIKey | BCEFSCDVGOHHOF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |