(2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid

C7H8N2O4 — CID 28777798

IUPAC(2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid
SMILESC[C@@H](NC(=O)c1ccno1)C(=O)O
InChIInChI=1S/C7H8N2O4/c1-4(7(11)12)9-6(10)5-2-3-8-13-5/h2-4H,1H3,(H,9,10)(H,11,12)/t4-/m1/s1
InChIKeySBRWLNGQTVTCBQ-SCSAIBSYSA-N
MW184.15 g/mol
LogP-0.12
Rot. Bonds3

About (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid

(2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid (PubChem CID 28777798) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid
PubChem CID28777798
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name(2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid
SMILESC[C@@H](NC(=O)c1ccno1)C(=O)O
InChIInChI=1S/C7H8N2O4/c1-4(7(11)12)9-6(10)5-2-3-8-13-5/h2-4H,1H3,(H,9,10)(H,11,12)/t4-/m1/s1
InChIKeySBRWLNGQTVTCBQ-SCSAIBSYSA-N
XLogP-0.12
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-0.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid?
The IUPAC name of (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid (CID 28777798) is (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid.
What is the SMILES notation for (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid?
The canonical SMILES for (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid is C[C@@H](NC(=O)c1ccno1)C(=O)O.
What is the InChIKey of (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid?
The InChIKey is SBRWLNGQTVTCBQ-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-4(7(11)12)9-6(10)5-2-3-8-13-5/h2-4H,1H3,(H,9,10)(H,11,12)/t4-/m1/s1.
What are the key properties of (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid?
(2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid has a molecular weight of 184.15 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,2-oxazole-5-carbonylamino)propanoic acid is sourced from PubChem (CID 28777798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).