About 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide
2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide (PubChem CID 60686110) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide.
Analyze 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide (CID 60686110) is 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide is CCN(CCO)C(C)C(=O)N(C)C.
What is the InChIKey of 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide?
The InChIKey is UJVHYDZLGBKFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-5-11(6-7-12)8(2)9(13)10(3)4/h8,12H,5-7H2,1-4H3.
What are the key properties of 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide?
2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide has a molecular weight of 188.27 g/mol, XLogP of -0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(2-hydroxyethyl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 60686110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).