C11H24N2O2 — CID 60686188
2-[ethyl(2-hydroxyethyl)amino]-N-(2-methylpropyl)propanamide (PubChem CID 60686188) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[ethyl(2-hydroxyethyl)amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 60686188 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-[ethyl(2-hydroxyethyl)amino]-N-(2-methylpropyl)propanamide |
| SMILES | CCN(CCO)C(C)C(=O)NCC(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-5-13(6-7-14)10(4)11(15)12-8-9(2)3/h9-10,14H,5-8H2,1-4H3,(H,12,15) |
| InChIKey | YUALVWAWZFADCS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |