C12H25N3OS — CID 54991974
2-[(3-amino-2-methyl-3-sulfanylidenepropyl)-methylamino]-N,N-diethylpropanamide (PubChem CID 54991974) has the molecular formula C12H25N3OS and a molecular weight of 259.42 g/mol. Its IUPAC name is 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)-methylamino]-N,N-diethylpropanamide.
| Compound Name | 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)-methylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 54991974 |
| Molecular Formula | C12H25N3OS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-[(3-amino-2-methyl-3-sulfanylidenepropyl)-methylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C)CC(C)C(N)=S |
| InChI | InChI=1S/C12H25N3OS/c1-6-15(7-2)12(16)10(4)14(5)8-9(3)11(13)17/h9-10H,6-8H2,1-5H3,(H2,13,17) |
| InChIKey | NDLLCFCXQLNBCY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|