C16H26FN3O — CID 43319089
2-[N-(3-aminopropyl)-2-fluoroanilino]-N,N-diethylpropanamide (PubChem CID 43319089) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-[N-(3-aminopropyl)-2-fluoroanilino]-N,N-diethylpropanamide.
| Compound Name | 2-[N-(3-aminopropyl)-2-fluoroanilino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43319089 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-[N-(3-aminopropyl)-2-fluoroanilino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(CCCN)c1ccccc1F |
| InChI | InChI=1S/C16H26FN3O/c1-4-19(5-2)16(21)13(3)20(12-8-11-18)15-10-7-6-9-14(15)17/h6-7,9-10,13H,4-5,8,11-12,18H2,1-3H3 |
| InChIKey | WQQDSGQXDISRCU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |