C9H18NO5P — CID 58288631
5-[methoxy(prop-2-enoyl)amino]pentylphosphonic acid (PubChem CID 58288631) has the molecular formula C9H18NO5P and a molecular weight of 251.22 g/mol. Its IUPAC name is 5-[methoxy(prop-2-enoyl)amino]pentylphosphonic acid.
| Compound Name | 5-[methoxy(prop-2-enoyl)amino]pentylphosphonic acid |
|---|---|
| PubChem CID | 58288631 |
| Molecular Formula | C9H18NO5P |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-[methoxy(prop-2-enoyl)amino]pentylphosphonic acid |
| SMILES | C=CC(=O)N(CCCCCP(=O)(O)O)OC |
| InChI | InChI=1S/C9H18NO5P/c1-3-9(11)10(15-2)7-5-4-6-8-16(12,13)14/h3H,1,4-8H2,2H3,(H2,12,13,14) |
| InChIKey | RBIZYEXXBPLELA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|