C11H15NO3 — CID 69013096
(4-hydroxyphenyl)methyl-propylcarbamic acid (PubChem CID 69013096) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (4-hydroxyphenyl)methyl-propylcarbamic acid.
| Compound Name | (4-hydroxyphenyl)methyl-propylcarbamic acid |
|---|---|
| PubChem CID | 69013096 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (4-hydroxyphenyl)methyl-propylcarbamic acid |
| SMILES | CCCN(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-2-7-12(11(14)15)8-9-3-5-10(13)6-4-9/h3-6,13H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | CXNYJCVCFSCYDF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |