C37H52O5Si — CID 66862235
3-[3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentyl]phenyl]butanoic acid (PubChem CID 66862235) has the molecular formula C37H52O5Si and a molecular weight of 604.90 g/mol. Its IUPAC name is 3-[3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentyl]phenyl]butanoic acid.
| Compound Name | 3-[3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 66862235 |
| Molecular Formula | C37H52O5Si |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | 3-[3-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxy-(3,5-dimethoxy-4-methylphenyl)methyl]-5-phenylpentyl]phenyl]butanoic acid |
| SMILES | COc1cc(C(O[Si](C)(C)C(C)(C)C)[C@H](CCCc2ccccc2)Cc2cccc(C(C)CC(=O)O)c2)cc(OC)c1C |
| InChI | InChI=1S/C37H52O5Si/c1-26(21-35(38)39)30-19-14-18-29(22-30)23-31(20-13-17-28-15-11-10-12-16-28)36(42-43(8,9)37(3,4)5)32-24-33(40-6)27(2)34(25-32)41-7/h10-12,14-16,18-19,22,24-26,31,36H,13,17,20-21,23H2,1-9H3,(H,38,39)/t26?,31-,36?/m1/s1 |
| InChIKey | UEEWTVBSODHPQF-JZQCRIPCSA-N |
| XLogP | 9.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|