C17H28N2O2S — CID 3611991
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3,3-dimethylbutan-2-yl)thiourea (PubChem CID 3611991) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3,3-dimethylbutan-2-yl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3,3-dimethylbutan-2-yl)thiourea |
|---|---|
| PubChem CID | 3611991 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3,3-dimethylbutan-2-yl)thiourea |
| SMILES | COc1ccc(CCNC(=S)NC(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H28N2O2S/c1-12(17(2,3)4)19-16(22)18-10-9-13-7-8-14(20-5)15(11-13)21-6/h7-8,11-12H,9-10H2,1-6H3,(H2,18,19,22) |
| InChIKey | PSVHJSLXHJDZOM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|