C17H26N2O3S — CID 2954792
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[1-(oxolan-2-yl)ethyl]thiourea (PubChem CID 2954792) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[1-(oxolan-2-yl)ethyl]thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[1-(oxolan-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 2954792 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[1-(oxolan-2-yl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)NC(C)C2CCCO2)cc1OC |
| InChI | InChI=1S/C17H26N2O3S/c1-12(14-5-4-10-22-14)19-17(23)18-9-8-13-6-7-15(20-2)16(11-13)21-3/h6-7,11-12,14H,4-5,8-10H2,1-3H3,(H2,18,19,23) |
| InChIKey | KILQWPLQZMLGEQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|