C28H54O5Si3 — CID 91742551
propyl 3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]benzoate (PubChem CID 91742551) has the molecular formula C28H54O5Si3 and a molecular weight of 554.99 g/mol. Its IUPAC name is propyl 3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]benzoate.
| Compound Name | propyl 3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]benzoate |
|---|---|
| PubChem CID | 91742551 |
| Molecular Formula | C28H54O5Si3 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | propyl 3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]benzoate |
| SMILES | CCCOC(=O)c1cc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H54O5Si3/c1-17-18-30-25(29)21-19-22(31-34(11,12)26(2,3)4)24(33-36(15,16)28(8,9)10)23(20-21)32-35(13,14)27(5,6)7/h19-20H,17-18H2,1-16H3 |
| InChIKey | ZIWFBRWAUNTIBM-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|