C33H52O6Si — CID 23657586
ethyl 4-[3-[tert-butyl(dimethyl)silyl]oxy-5-decoxyphenyl]-3,5-dimethoxybenzoate (PubChem CID 23657586) has the molecular formula C33H52O6Si and a molecular weight of 572.86 g/mol. Its IUPAC name is ethyl 4-[3-[tert-butyl(dimethyl)silyl]oxy-5-decoxyphenyl]-3,5-dimethoxybenzoate.
| Compound Name | ethyl 4-[3-[tert-butyl(dimethyl)silyl]oxy-5-decoxyphenyl]-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 23657586 |
| Molecular Formula | C33H52O6Si |
| Molecular Weight | 572.86 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | ethyl 4-[3-[tert-butyl(dimethyl)silyl]oxy-5-decoxyphenyl]-3,5-dimethoxybenzoate |
| SMILES | CCCCCCCCCCOc1cc(O[Si](C)(C)C(C)(C)C)cc(-c2c(OC)cc(C(=O)OCC)cc2OC)c1 |
| InChI | InChI=1S/C33H52O6Si/c1-10-12-13-14-15-16-17-18-19-38-27-20-25(21-28(24-27)39-40(8,9)33(3,4)5)31-29(35-6)22-26(23-30(31)36-7)32(34)37-11-2/h20-24H,10-19H2,1-9H3 |
| InChIKey | RQQAZKGBHZEZLG-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.86 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|