C21H29ClO2Si — CID 42642715
1-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]phenyl]propan-1-ol (PubChem CID 42642715) has the molecular formula C21H29ClO2Si and a molecular weight of 377.00 g/mol. Its IUPAC name is 1-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]phenyl]propan-1-ol.
| Compound Name | 1-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 42642715 |
| Molecular Formula | C21H29ClO2Si |
| Molecular Weight | 377.00 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-chlorophenyl]phenyl]propan-1-ol |
| SMILES | CCC(O)c1ccc(-c2ccc(O[Si](C)(C)C(C)(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H29ClO2Si/c1-7-19(23)16-10-8-15(9-11-16)17-12-13-20(18(22)14-17)24-25(5,6)21(2,3)4/h8-14,19,23H,7H2,1-6H3 |
| InChIKey | PPLVRRVYKAYLLF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.00 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|