C19H25ClO3Si — CID 175997347
2-[tert-butyl(dimethyl)silyl]oxy-4-chloro-6-[2-(hydroxymethyl)phenyl]phenol (PubChem CID 175997347) has the molecular formula C19H25ClO3Si and a molecular weight of 364.95 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-4-chloro-6-[2-(hydroxymethyl)phenyl]phenol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-chloro-6-[2-(hydroxymethyl)phenyl]phenol |
|---|---|
| PubChem CID | 175997347 |
| Molecular Formula | C19H25ClO3Si |
| Molecular Weight | 364.95 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-chloro-6-[2-(hydroxymethyl)phenyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(Cl)cc(-c2ccccc2CO)c1O |
| InChI | InChI=1S/C19H25ClO3Si/c1-19(2,3)24(4,5)23-17-11-14(20)10-16(18(17)22)15-9-7-6-8-13(15)12-21/h6-11,21-22H,12H2,1-5H3 |
| InChIKey | XNAQPHNFRWSPSF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.95 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|