C10H9F3O4 — CID 170997161
methyl 2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetate (PubChem CID 170997161) has the molecular formula C10H9F3O4 and a molecular weight of 250.17 g/mol. Its IUPAC name is methyl 2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetate.
| Compound Name | methyl 2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 170997161 |
| Molecular Formula | C10H9F3O4 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | methyl 2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetate |
| SMILES | COC(=O)Cc1cc(O)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3O4/c1-16-9(15)4-6-2-7(14)5-8(3-6)17-10(11,12)13/h2-3,5,14H,4H2,1H3 |
| InChIKey | PQBOHLABHXRWLY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |