C12H11F5O3 — CID 170998956
ethyl 2-[3-(difluoromethyl)-5-(trifluoromethoxy)phenyl]acetate (PubChem CID 170998956) has the molecular formula C12H11F5O3 and a molecular weight of 298.21 g/mol. Its IUPAC name is ethyl 2-[3-(difluoromethyl)-5-(trifluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[3-(difluoromethyl)-5-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 170998956 |
| Molecular Formula | C12H11F5O3 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | ethyl 2-[3-(difluoromethyl)-5-(trifluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC(F)(F)F)cc(C(F)F)c1 |
| InChI | InChI=1S/C12H11F5O3/c1-2-19-10(18)5-7-3-8(11(13)14)6-9(4-7)20-12(15,16)17/h3-4,6,11H,2,5H2,1H3 |
| InChIKey | DFNWHRFMDFGGHT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |