C53H65NO3SSi2 — CID 158892831
3-[4-[tert-butyl(diphenyl)silyl]oxybutoxy]-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propyl-4-(2-thiophen-2-ylethenyl)aniline (PubChem CID 158892831) has the molecular formula C53H65NO3SSi2 and a molecular weight of 852.35 g/mol. Its IUPAC name is 3-[4-[tert-butyl(diphenyl)silyl]oxybutoxy]-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propyl-4-(2-thiophen-2-ylethenyl)aniline.
| Compound Name | 3-[4-[tert-butyl(diphenyl)silyl]oxybutoxy]-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propyl-4-(2-thiophen-2-ylethenyl)aniline |
|---|---|
| PubChem CID | 158892831 |
| Molecular Formula | C53H65NO3SSi2 |
| Molecular Weight | 852.35 g/mol |
| Exact Mass | 851.42 |
| IUPAC Name | 3-[4-[tert-butyl(diphenyl)silyl]oxybutoxy]-N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propyl-4-(2-thiophen-2-ylethenyl)aniline |
| SMILES | CCCN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccc(C=Cc2cccs2)c(OCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C53H65NO3SSi2/c1-8-37-54(38-41-57-60(53(5,6)7,49-29-17-11-18-30-49)50-31-19-12-20-32-50)45-35-33-44(34-36-46-24-23-42-58-46)51(43-45)55-39-21-22-40-56-59(52(2,3)4,47-25-13-9-14-26-47)48-27-15-10-16-28-48/h9-20,23-36,42-43H,8,21-22,37-41H2,1-7H3 |
| InChIKey | CUROLLZWIMSTKL-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.35 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|