C26H22O5 — CID 127024734
4-[(2-methoxyphenyl)methoxy]-7-phenylmethoxynaphthalene-2-carboxylic acid (PubChem CID 127024734) has the molecular formula C26H22O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)methoxy]-7-phenylmethoxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[(2-methoxyphenyl)methoxy]-7-phenylmethoxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 127024734 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-[(2-methoxyphenyl)methoxy]-7-phenylmethoxynaphthalene-2-carboxylic acid |
| SMILES | COc1ccccc1COc1cc(C(=O)O)cc2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C26H22O5/c1-29-24-10-6-5-9-19(24)17-31-25-15-21(26(27)28)13-20-14-22(11-12-23(20)25)30-16-18-7-3-2-4-8-18/h2-15H,16-17H2,1H3,(H,27,28) |
| InChIKey | OOMVZMBAXRQHKS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |