C31H30O4SSi — CID 174143116
7-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-2,4-dioxabicyclo[3.3.1]nona-1(8),5(9),6-triene-3-thione (PubChem CID 174143116) has the molecular formula C31H30O4SSi and a molecular weight of 526.73 g/mol. Its IUPAC name is 7-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-2,4-dioxabicyclo[3.3.1]nona-1(8),5(9),6-triene-3-thione.
| Compound Name | 7-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-2,4-dioxabicyclo[3.3.1]nona-1(8),5(9),6-triene-3-thione |
|---|---|
| PubChem CID | 174143116 |
| Molecular Formula | C31H30O4SSi |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 7-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-2,4-dioxabicyclo[3.3.1]nona-1(8),5(9),6-triene-3-thione |
| SMILES | CC(C)(C)[Si](OCc1cc2cc(c1OCc1ccccc1)OC(=S)O2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30O4SSi/c1-31(2,3)37(26-15-9-5-10-16-26,27-17-11-6-12-18-27)33-22-24-19-25-20-28(35-30(36)34-25)29(24)32-21-23-13-7-4-8-14-23/h4-20H,21-22H2,1-3H3 |
| InChIKey | APLDQBGCCSWEGE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|