C25H24ClFO2Si — CID 177129267
tert-butyl-[(4-chloro-2-fluoro-1-benzofuran-7-yl)methoxy]-diphenylsilane (PubChem CID 177129267) has the molecular formula C25H24ClFO2Si and a molecular weight of 439.00 g/mol. Its IUPAC name is tert-butyl-[(4-chloro-2-fluoro-1-benzofuran-7-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4-chloro-2-fluoro-1-benzofuran-7-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 177129267 |
| Molecular Formula | C25H24ClFO2Si |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | tert-butyl-[(4-chloro-2-fluoro-1-benzofuran-7-yl)methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCc1ccc(Cl)c2cc(F)oc12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24ClFO2Si/c1-25(2,3)30(19-10-6-4-7-11-19,20-12-8-5-9-13-20)28-17-18-14-15-22(26)21-16-23(27)29-24(18)21/h4-16H,17H2,1-3H3 |
| InChIKey | VISZDCKWXYNAIY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|