C37H51ClO10Si — CID 67417361
tert-butyl-[[2-chloro-5-[(2S,3R,4R,5R)-3,4,5-tris(methoxymethoxy)-6-(methoxymethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane (PubChem CID 67417361) has the molecular formula C37H51ClO10Si and a molecular weight of 719.34 g/mol. Its IUPAC name is tert-butyl-[[2-chloro-5-[(2S,3R,4R,5R)-3,4,5-tris(methoxymethoxy)-6-(methoxymethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[2-chloro-5-[(2S,3R,4R,5R)-3,4,5-tris(methoxymethoxy)-6-(methoxymethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 67417361 |
| Molecular Formula | C37H51ClO10Si |
| Molecular Weight | 719.34 g/mol |
| Exact Mass | 718.29 |
| IUPAC Name | tert-butyl-[[2-chloro-5-[(2S,3R,4R,5R)-3,4,5-tris(methoxymethoxy)-6-(methoxymethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane |
| SMILES | COCOCC1O[C@@H](c2ccc(Cl)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)C(OCOC)[C@@H](OCOC)[C@@H]1OCOC |
| InChI | InChI=1S/C37H51ClO10Si/c1-37(2,3)49(29-14-10-8-11-15-29,30-16-12-9-13-17-30)47-21-28-20-27(18-19-31(28)38)33-35(45-25-41-6)36(46-26-42-7)34(44-24-40-5)32(48-33)22-43-23-39-4/h8-20,32-36H,21-26H2,1-7H3/t32?,33-,34+,35?,36-/m0/s1 |
| InChIKey | DQOUIBCYAUMPKQ-AITPOUKCSA-N |
| XLogP | 5.44 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|