C60H63ClO7Si — CID 90073607
tert-butyl-[[2-chloro-4-prop-2-enoxy-5-[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane (PubChem CID 90073607) has the molecular formula C60H63ClO7Si and a molecular weight of 959.70 g/mol. Its IUPAC name is tert-butyl-[[2-chloro-4-prop-2-enoxy-5-[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[2-chloro-4-prop-2-enoxy-5-[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 90073607 |
| Molecular Formula | C60H63ClO7Si |
| Molecular Weight | 959.70 g/mol |
| Exact Mass | 958.40 |
| IUPAC Name | tert-butyl-[[2-chloro-4-prop-2-enoxy-5-[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]-diphenylsilane |
| SMILES | C=CCOc1cc(Cl)c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C60H63ClO7Si/c1-5-36-63-54-38-53(61)49(43-67-69(60(2,3)4,50-32-20-10-21-33-50)51-34-22-11-23-35-51)37-52(54)56-58(65-41-47-28-16-8-17-29-47)59(66-42-48-30-18-9-19-31-48)57(64-40-46-26-14-7-15-27-46)55(68-56)44-62-39-45-24-12-6-13-25-45/h5-35,37-38,55-59H,1,36,39-44H2,2-4H3/t55-,56-,57+,58?,59+/m1/s1 |
| InChIKey | NOGSAXWIFHANAM-MWGMEAGESA-N |
| XLogP | 12.39 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.70 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|