C33H31Cl2NOSi — CID 172860203
[2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 172860203) has the molecular formula C33H31Cl2NOSi and a molecular weight of 556.61 g/mol. Its IUPAC name is [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 172860203 |
| Molecular Formula | C33H31Cl2NOSi |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCc1c(-c2ccccc2Cl)c[nH]c1-c1ccccc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31Cl2NOSi/c1-33(2,3)38(24-14-6-4-7-15-24,25-16-8-5-9-17-25)37-23-29-28(26-18-10-12-20-30(26)34)22-36-32(29)27-19-11-13-21-31(27)35/h4-22,36H,23H2,1-3H3 |
| InChIKey | ZGCBVVXNSBUIKM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|