About [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane
[2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 172860203) has the molecular formula C33H31Cl2NOSi
and a molecular weight of 556.61 g/mol. Its IUPAC name is [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane.
Molecular Properties
| Compound Name | [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane |
| PubChem CID | 172860203 |
| Molecular Formula | C33H31Cl2NOSi |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCc1c(-c2ccccc2Cl)c[nH]c1-c1ccccc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31Cl2NOSi/c1-33(2,3)38(24-14-6-4-7-15-24,25-16-8-5-9-17-25)37-23-29-28(26-18-10-12-20-30(26)34)22-36-32(29)27-19-11-13-21-31(27)35/h4-22,36H,23H2,1-3H3 |
| InChIKey | ZGCBVVXNSBUIKM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane?
The IUPAC name of [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane (CID 172860203) is [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane.
What is the SMILES notation for [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane?
The canonical SMILES for [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane is CC(C)(C)[Si](OCc1c(-c2ccccc2Cl)c[nH]c1-c1ccccc1Cl)(c1ccccc1)c1ccccc1.
What is the InChIKey of [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane?
The InChIKey is ZGCBVVXNSBUIKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H31Cl2NOSi/c1-33(2,3)38(24-14-6-4-7-15-24,25-16-8-5-9-17-25)37-23-29-28(26-18-10-12-20-30(26)34)22-36-32(29)27-19-11-13-21-31(27)35/h4-22,36H,23H2,1-3H3.
What are the key properties of [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane?
[2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane has a molecular weight of 556.61 g/mol, XLogP of 8.73, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(2-chlorophenyl)-1H-pyrrol-3-yl]methoxy-tert-butyl-diphenylsilane is sourced from PubChem (CID 172860203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).