C26H30Cl2N2O2Si — CID 10720224
2-amino-N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]-N-methylacetamide (PubChem CID 10720224) has the molecular formula C26H30Cl2N2O2Si and a molecular weight of 501.53 g/mol. Its IUPAC name is 2-amino-N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]-N-methylacetamide.
| Compound Name | 2-amino-N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 10720224 |
| Molecular Formula | C26H30Cl2N2O2Si |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-amino-N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]-N-methylacetamide |
| SMILES | CN(C(=O)CN)c1ccc(Cl)c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1Cl |
| InChI | InChI=1S/C26H30Cl2N2O2Si/c1-26(2,3)33(19-11-7-5-8-12-19,20-13-9-6-10-14-20)32-18-21-22(27)15-16-23(25(21)28)30(4)24(31)17-29/h5-16H,17-18,29H2,1-4H3 |
| InChIKey | OYMNDLMNOALWQZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|