C39H39Cl2N3O3Si — CID 18321794
4-[(E)-3-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 18321794) has the molecular formula C39H39Cl2N3O3Si and a molecular weight of 696.75 g/mol. Its IUPAC name is 4-[(E)-3-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18321794 |
| Molecular Formula | C39H39Cl2N3O3Si |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 695.21 |
| IUPAC Name | 4-[(E)-3-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)NCc2cccn2-c2ccc(Cl)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2Cl)cc1 |
| InChI | InChI=1S/C39H39Cl2N3O3Si/c1-39(2,3)48(31-13-7-5-8-14-31,32-15-9-6-10-16-32)47-27-33-34(40)22-23-35(37(33)41)44-25-11-12-30(44)26-43-36(45)24-19-28-17-20-29(21-18-28)38(46)42-4/h5-25H,26-27H2,1-4H3,(H,42,46)(H,43,45)/b24-19+ |
| InChIKey | RNTBNBCVRMHOHW-LYBHJNIJSA-N |
| XLogP | 7.55 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|