C22H20Cl2N4O3 — CID 54395194
3-(6-acetamido-3-pyridinyl)-N-[[1-[2,4-dichloro-3-(hydroxymethyl)phenyl]pyrrol-2-yl]methyl]prop-2-enamide (PubChem CID 54395194) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-(6-acetamido-3-pyridinyl)-N-[[1-[2,4-dichloro-3-(hydroxymethyl)phenyl]pyrrol-2-yl]methyl]prop-2-enamide.
| Compound Name | 3-(6-acetamido-3-pyridinyl)-N-[[1-[2,4-dichloro-3-(hydroxymethyl)phenyl]pyrrol-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 54395194 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 3-(6-acetamido-3-pyridinyl)-N-[[1-[2,4-dichloro-3-(hydroxymethyl)phenyl]pyrrol-2-yl]methyl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(C=CC(=O)NCc2cccn2-c2ccc(Cl)c(CO)c2Cl)cn1 |
| InChI | InChI=1S/C22H20Cl2N4O3/c1-14(30)27-20-8-4-15(11-25-20)5-9-21(31)26-12-16-3-2-10-28(16)19-7-6-18(23)17(13-29)22(19)24/h2-11,29H,12-13H2,1H3,(H,26,31)(H,25,27,30) |
| InChIKey | VJLGTWXHCWSUDY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|