C28H23Cl3N4O2 — CID 54189227
4-[3-[[1-[2,4-dichloro-3-(chloromethyl)phenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 54189227) has the molecular formula C28H23Cl3N4O2 and a molecular weight of 553.88 g/mol. Its IUPAC name is 4-[3-[[1-[2,4-dichloro-3-(chloromethyl)phenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-[3-[[1-[2,4-dichloro-3-(chloromethyl)phenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54189227 |
| Molecular Formula | C28H23Cl3N4O2 |
| Molecular Weight | 553.88 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 4-[3-[[1-[2,4-dichloro-3-(chloromethyl)phenyl]pyrrol-2-yl]methylamino]-3-oxoprop-1-enyl]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(C=Cc1ccc(C(=O)NCc2ccccn2)cc1)NCc1cccn1-c1ccc(Cl)c(CCl)c1Cl |
| InChI | InChI=1S/C28H23Cl3N4O2/c29-16-23-24(30)11-12-25(27(23)31)35-15-3-5-22(35)18-33-26(36)13-8-19-6-9-20(10-7-19)28(37)34-17-21-4-1-2-14-32-21/h1-15H,16-18H2,(H,33,36)(H,34,37) |
| InChIKey | PHHZZMODKGMUFO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.88 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|