C29H32Cl2N2OSi — CID 67675202
[1-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methanamine (PubChem CID 67675202) has the molecular formula C29H32Cl2N2OSi and a molecular weight of 523.58 g/mol. Its IUPAC name is [1-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methanamine.
| Compound Name | [1-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methanamine |
|---|---|
| PubChem CID | 67675202 |
| Molecular Formula | C29H32Cl2N2OSi |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [1-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methanamine |
| SMILES | CC(C)(C)[Si](OCCc1c(Cl)ccc(-n2cccc2CN)c1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32Cl2N2OSi/c1-29(2,3)35(23-12-6-4-7-13-23,24-14-8-5-9-15-24)34-20-18-25-26(30)16-17-27(28(25)31)33-19-10-11-22(33)21-32/h4-17,19H,18,20-21,32H2,1-3H3 |
| InChIKey | VXGCTXFLGAAEAR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|